![[ICO]](/icons/blank.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
I-DLE%20-%20Last%20Dance.jpg){kind=link}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| - .jpg | 2021-10-29 05:03 | 0 | |
| - [128]/ | 2021-10-29 05:03 | - | |
| - [320]/ | 2021-10-29 05:03 | - | |
| (G)I-DLE - Last Danc..> | 2021-10-29 10:22 | 103K | |
| GIDLE-Last Danceg.mp3 | 2021-10-29 10:23 | 3.0M | |
| Wheein-water color.mp3 | 2021-10-29 10:30 | 3.0M | |
| Wheein - water color..> | 2021-10-29 10:30 | 102K | |
| WENDY - When This Ra..> | 2021-10-29 10:34 | 38K | |
| WENDY-When This Rain..> | 2021-10-29 10:36 | 3.8M | |
| IU - Epilogue.jpg | 2021-10-29 10:41 | 220K | |
| IU-Epilogue.mp3 | 2021-10-29 10:43 | 3.9M | |
| IU - The Sea of a Ki..> | 2021-10-29 10:50 | 43K | |
| IU The Sea of a Kid ..> | 2021-10-29 10:51 | 5.3M | |
| IU-Coin.mp3 | 2021-10-29 10:54 | 3.4M | |
| IU - Coin.jpg | 2021-10-29 10:57 | 0 | |
